| Name | benzylurea |
| Synonyms | benzyl-ure benzylurea N-BENZYLUREA AKOS B028826 1-benzylurea benzylcarbamide phenylmethylurea (Phenylmethyl)urea (phenylmethyl)-ure LABOTEST-BB LT01690254 urea, N-(phenylmethyl)- |
| CAS | 538-32-9 |
| EINECS | 208-689-1 |
| InChI | InChI=1/C8H10N2O/c9-8(11)10-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10,11) |
| Molecular Formula | C8H10N2O |
| Molar Mass | 150.18 |
| Density | 1.1392 (rough estimate) |
| Melting Point | 149-151°C(lit.) |
| Boling Point | 271.72°C (rough estimate) |
| Flash Point | 124.9°C |
| Water Solubility | Slightly soluble in water. |
| Solubility | 17g/l |
| Vapor Presure | 0.00326mmHg at 25°C |
| Appearance | Powder |
| Color | White to off-white |
| Merck | 14,1147 |
| BRN | 2208083 |
| pKa | 14.18±0.50(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.6180 (estimate) |
| MDL | MFCD00007951 |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S22 - Do not breathe dust. |
| WGK Germany | 2 |
| RTECS | YS1780000 |
| HS Code | 2924 21 00 |
| Toxicity | LD50 orally in Rabbit: 4410 mg/kg |
| LogP | 0.73 at 20℃ |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 4410 mg/kg; Oral-mouse LD50: 570 mg/kg |
| flammability hazard characteristics | combustible; combustion produces toxic nitrogen oxide smoke |
| storage and transportation characteristics | low temperature ventilation and low drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |